What is the structural formula for 4 Ethyloctane?
C10H22
4-Ethyloctane | C10H22 – PubChem.
What is the correct name for 3 Propylhexane?
3-Propylhexane-2,3-diol
| PubChem CID | 458089 |
|---|---|
| Structure | Find Similar Structures |
| Molecular Formula | C9H20O2 |
| Synonyms | 3-propylhexane-2,3-diol 3-Propyl-2,3-hexanediol SCHEMBL3686300 |
| Molecular Weight | 160.25 |
What is the structure for 4 isopropyl 2 Methylnonane?
4-Isopropyl-2-methylthiazole | C7H11NS – PubChem.
What is the structure of isooctane?
C8H182,2,4-Trimethylpentane / Formula
Does 3 Heptyne exist?
3-Heptyne | C7H12 – PubChem.
What is the structure for Methylpropylamine?
N-Methylpropylamine
| PubChem CID | 12315 |
|---|---|
| Structure | Find Similar Structures |
| Chemical Safety | Laboratory Chemical Safety Summary (LCSS) Datasheet |
| Molecular Formula | C4H11N |
| Synonyms | N-METHYLPROPYLAMINE 627-35-0 N-Methyl-N-propylamine N-methylpropan-1-amine methyl(propyl)amine More… |
What is the correct structure for 3 fluoro 2 2 Dimethylpentane?
3-Fluoro-2,2-dimethylpentane
| PubChem CID | 88871753 |
|---|---|
| Structure | Find Similar Structures |
| Molecular Formula | C7H15F |
| Synonyms | SCHEMBL12050298 |
| Molecular Weight | 118.19 |
What is the difference between isooctane and octane?
Like octane, isooctane has eight carbon atoms and is also used as a fuel. Isooctane is an example of a branched chain hydrocarbon, and is a five carbon chain with three methyl groups at various points in the chain. Both ocatane and isooctane are isomers – they have the same molecular formula but different structures.
What is the condensed structural formula for 4-Propyloctane?
Identification of 4-propyloctane Chemical Compound
| Chemical Formula | C11H24 |
|---|---|
| IUPAC Name | 4-propyloctane |
| SMILES String | CCCCC(CCC)CCC |
| InChI | InChI=1S/C11H24/c1-4-7-10-11(8-5-2)9-6-3/h11H,4-10H2,1-3H3 |
| InChIKey | VFAMBAFLNKONTN-UHFFFAOYSA-N |