What is the molar mass of CCl?
153.81 grams per mole
The molar mass of carbon tetrachloride is 153.81 grams per mole.
What is the molecular formula for CCl?
Carbon Chloride Properties (Theoretical)
| Compound Formula | CCl4 |
|---|---|
| Molecular Weight | 153.82 |
| Appearance | Colorless liquid |
| Melting Point | -22.92° C (-9.256° F) |
| Boiling Point | N/A |
What is the empirical formula for naphthalene?
C5H4
Thus naphthalene contains a 1.25:1 ratio of moles of carbon to moles of hydrogen: C1.25H1.0. Because the ratios of the elements in the empirical formula must be expressed as small whole numbers, multiply both subscripts by 4, which gives C5H4 as the empirical formula of naphthalene.
What is the name of CCl4?
TetrachloromethaneCarbon tetrachloride / IUPAC ID
Carbon tetrachloride, also known by many other names (such as tetrachloromethane, also recognised by the IUPAC, carbon tet in the cleaning industry, Halon-104 in firefighting, and Refrigerant-10 in HVACR) is an organic compound with the chemical formula CCl4.
How CCl4 is formed?
First prepared in 1839 by the reaction of chloroform with chlorine, carbon tetrachloride is manufactured by the reaction of chlorine with carbon disulfide or with methane.
What is the IUPAC name for Cl CH 2 2 CH 2 Cl?
methylene chloride dichloromethane
Skill-Building Exercise
| Formula | Common Name | IUPAC Name |
|---|---|---|
| CH 2Cl 2 | methylene chloride | dichloromethane |
| CHCl 3 | chloroform | trichloromethane |
| CCl 4 | carbon tetrachloride | tetrachloromethane |
| CBrF 3 | halon-1301 | bromotrifluoromethane |
What is the molar mass of naphthalene?
128.1705 g/molNaphthalene / Molar mass
What is the empirical formula of naphthalene C10H4?
Identification of Naphthalene Chemical Compound
| Chemical Formula | C10H4 |
|---|---|
| IUPAC Name | naphthalene |
| SMILES String | [c]2[c][c]c1ccccc1[c]2 |
| InChI | InChI=1S/C10H4/c1-2-6-10-8-4-3-7-9(10)5-1/h1-2,5-6H |
| InChIKey | UEBOXFBWXWTPKD-UHFFFAOYSA-N |
What is the molecular shape of CCl4?
The structure will be tetrahedral.
What is the correct molecular mass of CCl4 C 12g CL 35g?
154.00⋅g/mol.